C27H42O4 — CID 90882626
[(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylpropanoate (PubChem CID 90882626) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90882626 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylpropanoate |
| SMILES | C=C1[C@H](O)CC(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)COC(=O)C(C)(C)C)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C27H42O4/c1-17(16-31-25(30)26(3,4)5)21-11-12-22-20(8-7-13-27(21,22)6)10-9-19-14-23(28)18(2)24(29)15-19/h9-10,17,21-24,28-29H,2,7-8,11-16H2,1,3-6H3/t17-,21-,22+,23-,24-,27-/m1/s1 |
| InChIKey | UNPXZJQJVLDGGC-HYFCVWBMSA-N |
| XLogP | 5.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|