C27H44O4 — CID 156963766
5-[(2E)-2-[1-[1-(3-hydroxy-2,3-dimethylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 156963766) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 5-[(2E)-2-[1-[1-(3-hydroxy-2,3-dimethylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | 5-[(2E)-2-[1-[1-(3-hydroxy-2,3-dimethylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 156963766 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 5-[(2E)-2-[1-[1-(3-hydroxy-2,3-dimethylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(O)CC(=C/C=C2\CCCC3(C)C2CCC3C(C)OCC(C)C(C)(C)O)CC1O |
| InChI | InChI=1S/C27H44O4/c1-17(26(4,5)30)16-31-19(3)22-11-12-23-21(8-7-13-27(22,23)6)10-9-20-14-24(28)18(2)25(29)15-20/h9-10,17,19,22-25,28-30H,2,7-8,11-16H2,1,3-6H3/b20-9?,21-10+ |
| InChIKey | UECLGFUOBJOZRT-ADGJULBNSA-N |
| XLogP | 4.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|