C28H44O4 — CID 91141774
[(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylbutanoate (PubChem CID 91141774) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylbutanoate.
| Compound Name | [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91141774 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | [(2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-dihydroxy-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 2,2-dimethylbutanoate |
| SMILES | C=C1[C@H](O)CC(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)COC(=O)C(C)(C)CC)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C28H44O4/c1-7-27(4,5)26(31)32-17-18(2)22-12-13-23-21(9-8-14-28(22,23)6)11-10-20-15-24(29)19(3)25(30)16-20/h10-11,18,22-25,29-30H,3,7-9,12-17H2,1-2,4-6H3/t18-,22-,23+,24-,25-,28-/m1/s1 |
| InChIKey | LWKKPNVZAWTQJJ-HUJZPJBXSA-N |
| XLogP | 5.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|