C28H53BO3Si — CID 11442946
[(6R)-6-[(1R,4E,7aR)-7a-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane (PubChem CID 11442946) has the molecular formula C28H53BO3Si and a molecular weight of 476.63 g/mol. Its IUPAC name is [(6R)-6-[(1R,4E,7aR)-7a-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane.
| Compound Name | [(6R)-6-[(1R,4E,7aR)-7a-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11442946 |
| Molecular Formula | C28H53BO3Si |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | [(6R)-6-[(1R,4E,7aR)-7a-methyl-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-trimethylsilane |
| SMILES | C[C@H](CCCC(C)(C)O[Si](C)(C)C)[C@H]1CCC2/C(=C/B3OC(C)(C)C(C)(C)O3)CCC[C@@]21C |
| InChI | InChI=1S/C28H53BO3Si/c1-21(14-12-18-25(2,3)32-33(9,10)11)23-16-17-24-22(15-13-19-28(23,24)8)20-29-30-26(4,5)27(6,7)31-29/h20-21,23-24H,12-19H2,1-11H3/b22-20+/t21-,23-,24?,28-/m1/s1 |
| InChIKey | YXYOJXIXQIAUJA-YBZWFNHDSA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|