C24H39F3O3 — CID 71021053
(7aR)-7a-methyl-1-[(E,6R)-1,1,1-trifluoro-2,10-dihydroxy-2,6,10-trimethylundec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 71021053) has the molecular formula C24H39F3O3 and a molecular weight of 432.57 g/mol. Its IUPAC name is (7aR)-7a-methyl-1-[(E,6R)-1,1,1-trifluoro-2,10-dihydroxy-2,6,10-trimethylundec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (7aR)-7a-methyl-1-[(E,6R)-1,1,1-trifluoro-2,10-dihydroxy-2,6,10-trimethylundec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71021053 |
| Molecular Formula | C24H39F3O3 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (7aR)-7a-methyl-1-[(E,6R)-1,1,1-trifluoro-2,10-dihydroxy-2,6,10-trimethylundec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(O)CCC[C@](C)(C/C=C/C(C)(O)C(F)(F)F)C1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C24H39F3O3/c1-20(2,29)12-7-13-21(3,14-8-16-23(5,30)24(25,26)27)19-11-10-17-18(28)9-6-15-22(17,19)4/h8,16-17,19,29-30H,6-7,9-15H2,1-5H3/b16-8+/t17?,19?,21-,22+,23?/m1/s1 |
| InChIKey | RKSRVEJDZPTSIA-CXKGTTNUSA-N |
| XLogP | 5.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|