C30H52F6O3Si2 — CID 87500099
(7aR)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-6,10-dimethyl-2-(trifluoromethyl)-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 87500099) has the molecular formula C30H52F6O3Si2 and a molecular weight of 630.90 g/mol. Its IUPAC name is (7aR)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-6,10-dimethyl-2-(trifluoromethyl)-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (7aR)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-6,10-dimethyl-2-(trifluoromethyl)-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 87500099 |
| Molecular Formula | C30H52F6O3Si2 |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | (7aR)-7a-methyl-1-[(Z,6S)-1,1,1-trifluoro-6,10-dimethyl-2-(trifluoromethyl)-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(CCC[C@@](C)(C/C=C\C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)C1CCC2C(=O)CCC[C@@]21C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H52F6O3Si2/c1-25(2,38-40(5,6)7)17-12-18-26(3,24-16-15-22-23(37)14-11-20-27(22,24)4)19-13-21-28(29(31,32)33,30(34,35)36)39-41(8,9)10/h13,21-22,24H,11-12,14-20H2,1-10H3/b21-13-/t22?,24?,26-,27-/m0/s1 |
| InChIKey | VOVSMCNHXBYFMO-PSWMMHQSSA-N |
| XLogP | 10.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|