C22H30F6O2Si — CID 87746297
(3aR,7aR)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-one (PubChem CID 87746297) has the molecular formula C22H30F6O2Si and a molecular weight of 468.55 g/mol. Its IUPAC name is (3aR,7aR)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-one.
| Compound Name | (3aR,7aR)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-one |
|---|---|
| PubChem CID | 87746297 |
| Molecular Formula | C22H30F6O2Si |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (3aR,7aR)-7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-(trifluoromethyl)-4-trimethylsilyloxypent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-one |
| SMILES | C[C@@]12CCCC(=O)[C@@H]1CC=C2C1(C/C=C/C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H30F6O2Si/c1-18-10-5-7-16(29)15(18)8-9-17(18)19(13-14-19)11-6-12-20(21(23,24)25,22(26,27)28)30-31(2,3)4/h6,9,12,15H,5,7-8,10-11,13-14H2,1-4H3/b12-6+/t15-,18+/m0/s1 |
| InChIKey | ZPUJREIUPCAKJV-ZCPKQWRTSA-N |
| XLogP | 7.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|