C19H24F6O2 — CID 91481891
(1R,7aR)-7a-methyl-1-[1-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 91481891) has the molecular formula C19H24F6O2 and a molecular weight of 398.39 g/mol. Its IUPAC name is (1R,7aR)-7a-methyl-1-[1-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-7a-methyl-1-[1-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 91481891 |
| Molecular Formula | C19H24F6O2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1R,7aR)-7a-methyl-1-[1-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@]12CCCC(=O)C1CC[C@@H]2C1(CC=CC(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H24F6O2/c1-15-7-2-4-13(26)12(15)5-6-14(15)16(10-11-16)8-3-9-17(27,18(20,21)22)19(23,24)25/h3,9,12,14,27H,2,4-8,10-11H2,1H3/t12?,14-,15-/m0/s1 |
| InChIKey | RKDYXHQRTLDBIL-ZRNAQANOSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|