C19H26F6O2 — CID 18381469
7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 18381469) has the molecular formula C19H26F6O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | 7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 18381469 |
| Molecular Formula | C19H26F6O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 7a-methyl-1-[1-[(E)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC12CCCC(O)C1CCC2C1(C/C=C/C(O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H26F6O2/c1-15-7-2-4-13(26)12(15)5-6-14(15)16(10-11-16)8-3-9-17(27,18(20,21)22)19(23,24)25/h3,9,12-14,26-27H,2,4-8,10-11H2,1H3/b9-3+ |
| InChIKey | JVUZZOOAWZGOPN-YCRREMRBSA-N |
| XLogP | 5.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|