C27H47F3O2 — CID 143298721
(1R)-7a-methyl-1-(7-methyloctan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;(Z)-1,1,1-trifluoro-2-methylhept-4-en-2-ol (PubChem CID 143298721) has the molecular formula C27H47F3O2 and a molecular weight of 460.67 g/mol. Its IUPAC name is (1R)-7a-methyl-1-(7-methyloctan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;(Z)-1,1,1-trifluoro-2-methylhept-4-en-2-ol.
| Compound Name | (1R)-7a-methyl-1-(7-methyloctan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;(Z)-1,1,1-trifluoro-2-methylhept-4-en-2-ol |
|---|---|
| PubChem CID | 143298721 |
| Molecular Formula | C27H47F3O2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | (1R)-7a-methyl-1-(7-methyloctan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;(Z)-1,1,1-trifluoro-2-methylhept-4-en-2-ol |
| SMILES | CC(C)CCCCC(C)[C@H]1CCC2C(=O)CCCC21C.CC/C=C\CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C19H34O.C8H13F3O/c1-14(2)8-5-6-9-15(3)16-11-12-17-18(20)10-7-13-19(16,17)4;1-3-4-5-6-7(2,12)8(9,10)11/h14-17H,5-13H2,1-4H3;4-5,12H,3,6H2,1-2H3/b;5-4-/t15?,16-,17?,19?;/m1./s1 |
| InChIKey | QBAUDCUQBGHQSI-SSBSTUHHSA-N |
| XLogP | 8.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|