C11H18O — CID 59084008
(3aR,7aR)-1,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59084008) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3aR,7aR)-1,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (3aR,7aR)-1,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59084008 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3aR,7aR)-1,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C11H18O/c1-8-5-6-9-10(12)4-3-7-11(8,9)2/h8-9H,3-7H2,1-2H3/t8?,9-,11+/m0/s1 |
| InChIKey | WWLYQRNPZFYWCS-CAWIPBJDSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |