C12H20 — CID 142040574
(3aS)-1,7a-dimethyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 142040574) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (3aS)-1,7a-dimethyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (3aS)-1,7a-dimethyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 142040574 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (3aS)-1,7a-dimethyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CCCC2(C)C(C)CC[C@@H]12 |
| InChI | InChI=1S/C12H20/c1-9-5-4-8-12(3)10(2)6-7-11(9)12/h10-11H,1,4-8H2,2-3H3/t10?,11-,12?/m0/s1 |
| InChIKey | AKWNYKNECJRJQZ-CXQJBGSLSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|