C22H36 — CID 59079208
(4E)-1,7a-dimethyl-4-[(2Z)-2-[(3S,5S)-2,3,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 59079208) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (4E)-1,7a-dimethyl-4-[(2Z)-2-[(3S,5S)-2,3,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-1,7a-dimethyl-4-[(2Z)-2-[(3S,5S)-2,3,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 59079208 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (4E)-1,7a-dimethyl-4-[(2Z)-2-[(3S,5S)-2,3,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CC1/C(=C\C=C2/CCCC3(C)C(C)CCC23)C[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C22H36/c1-15-13-16(2)18(4)20(14-15)10-9-19-7-6-12-22(5)17(3)8-11-21(19)22/h9-10,15-18,21H,6-8,11-14H2,1-5H3/b19-9+,20-10-/t15-,16-,17?,18?,21?,22?/m0/s1 |
| InChIKey | MJNQOOWVXBBVDT-CDZOPCBJSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |