C20H34 — CID 143488970
1-[(E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 143488970) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1-[(E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 1-[(E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 143488970 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1-[(E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CCCC2(C)C1CCC2C(C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C20H34/c1-14(2)15(3)9-10-17(5)19-12-11-18-16(4)8-7-13-20(18,19)6/h9-10,14-15,17-19H,4,7-8,11-13H2,1-3,5-6H3/b10-9+/t15-,17?,18?,19?,20?/m0/s1 |
| InChIKey | XCPICNRJJVYVLL-LTFLOOJUSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|