C28H44O3 — CID 87805756
(3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-methylidenecyclohexane-1,1,3-triol (PubChem CID 87805756) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-methylidenecyclohexane-1,1,3-triol.
| Compound Name | (3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-methylidenecyclohexane-1,1,3-triol |
|---|---|
| PubChem CID | 87805756 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-6-methylidenecyclohexane-1,1,3-triol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@@]3(C)[C@H]2CC[C@H]3[C@H](C)/C=C/[C@H](C)C(C)C)C[C@@H](O)CC1(O)O |
| InChI | InChI=1S/C28H44O3/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-27(25,26)6)11-12-23-16-24(29)17-28(30,31)21(23)5/h9-12,18-20,24-26,29-31H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25-,26-,27+/m0/s1 |
| InChIKey | YRYCSIGHPLVYMJ-SOJAQKDISA-N |
| XLogP | 5.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|