C28H44O3 — CID 87356445
(2S)-4-[2-[(1R,7aR)-1-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-methylidenecyclohexane-1,2,3-triol (PubChem CID 87356445) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (2S)-4-[2-[(1R,7aR)-1-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-methylidenecyclohexane-1,2,3-triol.
| Compound Name | (2S)-4-[2-[(1R,7aR)-1-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-methylidenecyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 87356445 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (2S)-4-[2-[(1R,7aR)-1-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-methylidenecyclohexane-1,2,3-triol |
| SMILES | C=C1CC(O)[C@H](O)C(O)C1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)/C=C/[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H44O3/c1-17(2)18(3)9-10-19(4)23-13-14-24-21(8-7-15-28(23,24)6)11-12-22-20(5)16-25(29)27(31)26(22)30/h9-12,17-19,23-27,29-31H,5,7-8,13-16H2,1-4,6H3/b10-9+,21-11?,22-12?/t18-,19-,23-,24?,25?,26?,27+,28-/m1/s1 |
| InChIKey | SLKNTJYCDPZKBX-HMJCIOFYSA-N |
| XLogP | 5.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|