C28H46O2 — CID 90852189
3-[1-[1-(5,6-dimethylhept-3-en-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-3-hydroxypropan-2-yl]-2-methylidenecyclopentan-1-ol (PubChem CID 90852189) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is 3-[1-[1-(5,6-dimethylhept-3-en-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-3-hydroxypropan-2-yl]-2-methylidenecyclopentan-1-ol.
| Compound Name | 3-[1-[1-(5,6-dimethylhept-3-en-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-3-hydroxypropan-2-yl]-2-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 90852189 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 3-[1-[1-(5,6-dimethylhept-3-en-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-3-hydroxypropan-2-yl]-2-methylidenecyclopentan-1-ol |
| SMILES | C=C1C(O)CCC1C(C=C1CCCC2(C)C1CCC2C(C)C=CC(C)C(C)C)CO |
| InChI | InChI=1S/C28H46O2/c1-18(2)19(3)9-10-20(4)25-12-13-26-22(8-7-15-28(25,26)6)16-23(17-29)24-11-14-27(30)21(24)5/h9-10,16,18-20,23-27,29-30H,5,7-8,11-15,17H2,1-4,6H3 |
| InChIKey | ZORJPVNKFRWLGU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|