C29H46O2 — CID 89395301
1-[(2E)-2-[(1R,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol (PubChem CID 89395301) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1-[(2E)-2-[(1R,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol.
| Compound Name | 1-[(2E)-2-[(1R,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 89395301 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1-[(2E)-2-[(1R,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol |
| SMILES | C=C1C(O)CC2CC12C(/C=C1\CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)/C=C/[C@H](C)C(C)C)OC |
| InChI | InChI=1S/C29H46O2/c1-18(2)19(3)10-11-20(4)24-12-13-25-22(9-8-14-28(24,25)6)15-27(31-7)29-17-23(29)16-26(30)21(29)5/h10-11,15,18-20,23-27,30H,5,8-9,12-14,16-17H2,1-4,6-7H3/b11-10+,22-15+/t19-,20+,23?,24+,25?,26?,27?,28+,29?/m0/s1 |
| InChIKey | GECIUDQXYWVFAZ-UDDNZENISA-N |
| XLogP | 6.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|