C27H44O3 — CID 67742679
(1R,3R,5R)-1-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol (PubChem CID 67742679) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (1R,3R,5R)-1-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol.
| Compound Name | (1R,3R,5R)-1-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 67742679 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (1R,3R,5R)-1-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-methoxyethyl]-2-methylidenebicyclo[3.1.0]hexan-3-ol |
| SMILES | C=C1[C@H](O)C[C@H]2C[C@]12C(/C=C1\CCC[C@]2(C)[C@@H](CCCCC(C)(C)O)CC[C@@H]12)OC |
| InChI | InChI=1S/C27H44O3/c1-18-23(28)16-21-17-27(18,21)24(30-5)15-19-9-8-14-26(4)20(11-12-22(19)26)10-6-7-13-25(2,3)29/h15,20-24,28-29H,1,6-14,16-17H2,2-5H3/b19-15+/t20-,21-,22-,23+,24?,26+,27-/m0/s1 |
| InChIKey | BGLXZCNNCRLWAH-SEVPISOHSA-N |
| XLogP | 5.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|