C29H48O4 — CID 134477300
cis-(1R,2S,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropoxy)-4-methylidenecyclohexan-1-ol (PubChem CID 134477300) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is cis-(1R,2S,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropoxy)-4-methylidenecyclohexan-1-ol.
| Compound Name | cis-(1R,2S,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropoxy)-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 134477300 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | cis-(1R,2S,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropoxy)-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1C[C@H](OCCCO)[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)[C@@H](CCCCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C29H48O4/c1-21-19-27(33-18-8-17-30)26(31)20-23(21)12-11-22-9-7-16-29(4)24(13-14-25(22)29)10-5-6-15-28(2,3)32/h11-12,24-27,30-32H,1,5-10,13-20H2,2-4H3/b22-11+,23-12-/t24-,25-,26+,27-,29+/m0/s1 |
| InChIKey | VXHBLEFXQPEEBM-WGDAHNRUSA-N |
| XLogP | 5.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|