C27H44 — CID 153370565
(4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(4-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 153370565) has the molecular formula C27H44 and a molecular weight of 368.65 g/mol. Its IUPAC name is (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(4-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(4-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 153370565 |
| Molecular Formula | C27H44 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(4-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC(C)CC/C1=C\C=C1/CCCC2(C)C(CCCCC(C)C)CCC12 |
| InChI | InChI=1S/C27H44/c1-20(2)9-6-7-11-25-16-17-26-24(10-8-18-27(25,26)5)15-14-23-13-12-21(3)19-22(23)4/h14-15,20-21,25-26H,4,6-13,16-19H2,1-3,5H3/b23-14+,24-15+ |
| InChIKey | OIUMWYPHZUBQFB-OZEVPFDHSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|