C32H57N — CID 153370598
(4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(2-methylidene-5-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane;methanamine (PubChem CID 153370598) has the molecular formula C32H57N and a molecular weight of 455.82 g/mol. Its IUPAC name is (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(2-methylidene-5-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane;methanamine.
| Compound Name | (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(2-methylidene-5-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane;methanamine |
|---|---|
| PubChem CID | 153370598 |
| Molecular Formula | C32H57N |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.45 |
| IUPAC Name | (4E)-7a-methyl-1-(5-methylhexyl)-4-[(2E)-2-(2-methylidene-5-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane;methanamine |
| SMILES | C=C1CCC(C(=C)C)C/C1=C\C=C1/CCCC2(C)C(CCCCC(C)C)CCC12.CC.CN |
| InChI | InChI=1S/C29H46.C2H6.CH5N/c1-21(2)10-7-8-12-27-17-18-28-24(11-9-19-29(27,28)6)15-16-26-20-25(22(3)4)14-13-23(26)5;2*1-2/h15-16,21,25,27-28H,3,5,7-14,17-20H2,1-2,4,6H3;1-2H3;2H2,1H3/b24-15+,26-16+;; |
| InChIKey | GPWMPQDGACKIKC-YJTFJGPGSA-N |
| XLogP | 9.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|