C26H40 — CID 143647718
(4E,7aR)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 143647718) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is (4E,7aR)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E,7aR)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 143647718 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | (4E,7aR)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CCCC/C1=C/C=C1\CCC[C@]2(C)C(C/C=C/CC(C)C)CCC12 |
| InChI | InChI=1S/C26H40/c1-20(2)10-5-8-14-24-17-18-25-23(13-9-19-26(24,25)4)16-15-22-12-7-6-11-21(22)3/h5,8,15-16,20,24-25H,3,6-7,9-14,17-19H2,1-2,4H3/b8-5+,22-15-,23-16+/t24?,25?,26-/m1/s1 |
| InChIKey | DZFZAISAUXGXOA-GVBDZVJCSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|