C29H46 — CID 176858105
(1R,4E,7aR)-1-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-7a-methyl-4-[(2E)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 176858105) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is (1R,4E,7aR)-1-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-7a-methyl-4-[(2E)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (1R,4E,7aR)-1-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-7a-methyl-4-[(2E)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 176858105 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | (1R,4E,7aR)-1-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-7a-methyl-4-[(2E)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CCCC/C1=C\C=C1/CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)/C=C/[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H46/c1-7-24(21(2)3)15-14-23(5)27-18-19-28-26(13-10-20-29(27,28)6)17-16-25-12-9-8-11-22(25)4/h14-17,21,23-24,27-28H,4,7-13,18-20H2,1-3,5-6H3/b15-14+,25-16+,26-17+/t23-,24-,27-,28?,29-/m1/s1 |
| InChIKey | VEEMOAFRYJNDTD-RPEWGEBKSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|