C31H48 — CID 153370570
(4E)-1-[(E)-4,5-dimethylhex-2-enyl]-7a-methyl-4-[(2E)-2-(4-methyl-2-methylidene-4-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 153370570) has the molecular formula C31H48 and a molecular weight of 420.73 g/mol. Its IUPAC name is (4E)-1-[(E)-4,5-dimethylhex-2-enyl]-7a-methyl-4-[(2E)-2-(4-methyl-2-methylidene-4-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-1-[(E)-4,5-dimethylhex-2-enyl]-7a-methyl-4-[(2E)-2-(4-methyl-2-methylidene-4-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 153370570 |
| Molecular Formula | C31H48 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | (4E)-1-[(E)-4,5-dimethylhex-2-enyl]-7a-methyl-4-[(2E)-2-(4-methyl-2-methylidene-4-prop-1-en-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC(C)(C(=C)C)CC/C1=C\C=C1/CCCC2(C)C(C/C=C/C(C)C(C)C)CCC12 |
| InChI | InChI=1S/C31H48/c1-22(2)24(5)11-9-13-28-16-17-29-27(12-10-19-31(28,29)8)15-14-26-18-20-30(7,23(3)4)21-25(26)6/h9,11,14-15,22,24,28-29H,3,6,10,12-13,16-21H2,1-2,4-5,7-8H3/b11-9+,26-14+,27-15+ |
| InChIKey | XPXKXXQIUGHYAY-QUUTXRRDSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|