C28H40O4 — CID 10194959
[(E)-1-cyclopropyl-4-[(4E)-4-[(2Z)-2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enyl] acetate (PubChem CID 10194959) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is [(E)-1-cyclopropyl-4-[(4E)-4-[(2Z)-2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enyl] acetate.
| Compound Name | [(E)-1-cyclopropyl-4-[(4E)-4-[(2Z)-2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enyl] acetate |
|---|---|
| PubChem CID | 10194959 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | [(E)-1-cyclopropyl-4-[(4E)-4-[(2Z)-2-(3,5-dihydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]but-2-enyl] acetate |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(C/C=C/C(OC(C)=O)C4CC4)CCC23)CC(O)CC1O |
| InChI | InChI=1S/C28H40O4/c1-18-22(16-24(30)17-26(18)31)12-9-20-6-5-15-28(3)23(13-14-25(20)28)7-4-8-27(21-10-11-21)32-19(2)29/h4,8-9,12,21,23-27,30-31H,1,5-7,10-11,13-17H2,2-3H3/b8-4+,20-9+,22-12- |
| InChIKey | TYIJLZMZJSNGRX-JETBMICMSA-N |
| XLogP | 5.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|