C26H36O4 — CID 123937715
4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylbutane-1,3-dione (PubChem CID 123937715) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylbutane-1,3-dione.
| Compound Name | 4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylbutane-1,3-dione |
|---|---|
| PubChem CID | 123937715 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-[(1R,7aR)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylbutane-1,3-dione |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3CC(=O)CC(=O)C2CC2)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H36O4/c1-16-19(12-21(27)14-24(16)29)8-5-17-4-3-11-26(2)20(9-10-23(17)26)13-22(28)15-25(30)18-6-7-18/h5,8,18,20-21,23-24,27,29H,1,3-4,6-7,9-15H2,2H3/t20-,21-,23?,24+,26-/m1/s1 |
| InChIKey | HJJBIIHXQSHQIQ-HHEXUCIKSA-N |
| XLogP | 4.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|