C26H38O — CID 143226984
6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhex-3-yn-2-ol (PubChem CID 143226984) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is 6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhex-3-yn-2-ol.
| Compound Name | 6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhex-3-yn-2-ol |
|---|---|
| PubChem CID | 143226984 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhex-3-yn-2-ol |
| SMILES | C=C1CCCC/C1=C/C=C1\CCCC2(C)C(CCC#CC(C)(C)O)CCC12 |
| InChI | InChI=1S/C26H38O/c1-20-10-5-6-11-21(20)14-15-22-12-9-19-26(4)23(16-17-24(22)26)13-7-8-18-25(2,3)27/h14-15,23-24,27H,1,5-7,9-13,16-17,19H2,2-4H3/b21-14-,22-15+ |
| InChIKey | YIJRNJIQRWWQNZ-BILXGNRESA-N |
| XLogP | 6.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|