C24H34O2 — CID 142600853
(1S,3Z)-3-[(2E)-2-[1-(3-hydroxy-3-methylbut-1-ynyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 142600853) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[1-(3-hydroxy-3-methylbut-1-ynyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[1-(3-hydroxy-3-methylbut-1-ynyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 142600853 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[1-(3-hydroxy-3-methylbut-1-ynyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(C#CC(C)(C)O)CCC23)CCC[C@@H]1O |
| InChI | InChI=1S/C24H34O2/c1-17-18(7-5-9-22(17)25)10-11-19-8-6-15-24(4)20(12-13-21(19)24)14-16-23(2,3)26/h10-11,20-22,25-26H,1,5-9,12-13,15H2,2-4H3/b18-10-,19-11+/t20?,21?,22-,24?/m0/s1 |
| InChIKey | IJZZWXIMKIZNEG-DIVYUSABSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|