C28H45NO3 — CID 143259306
N-[(2S)-2-[(1R,3aS,4E)-4-[(2Z)-2-(3-hydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-N,2,2-trimethylpropanamide (PubChem CID 143259306) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is N-[(2S)-2-[(1R,3aS,4E)-4-[(2Z)-2-(3-hydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-N,2,2-trimethylpropanamide.
| Compound Name | N-[(2S)-2-[(1R,3aS,4E)-4-[(2Z)-2-(3-hydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 143259306 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | N-[(2S)-2-[(1R,3aS,4E)-4-[(2Z)-2-(3-hydroxy-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-N,2,2-trimethylpropanamide |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)[C@@H]([C@H](C)CON(C)C(=O)C(C)(C)C)CC[C@@H]23)CCCC1O |
| InChI | InChI=1S/C28H45NO3/c1-19(18-32-29(7)26(31)27(3,4)5)23-15-16-24-22(11-9-17-28(23,24)6)14-13-21-10-8-12-25(30)20(21)2/h13-14,19,23-25,30H,2,8-12,15-18H2,1,3-7H3/b21-13-,22-14+/t19-,23-,24+,25?,28?/m1/s1 |
| InChIKey | YHGNPUYBLIMMGD-OILRJGQUSA-N |
| XLogP | 6.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|