C22H34O — CID 90736483
2-[7a-methyl-4-[2-(3-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol (PubChem CID 90736483) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-[7a-methyl-4-[2-(3-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol.
| Compound Name | 2-[7a-methyl-4-[2-(3-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol |
|---|---|
| PubChem CID | 90736483 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[7a-methyl-4-[2-(3-methyl-2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol |
| SMILES | C=C1C(=CC=C2CCCC3(C)C(CCO)CCC23)CCCC1C |
| InChI | InChI=1S/C22H34O/c1-16-6-4-7-18(17(16)2)9-10-19-8-5-14-22(3)20(13-15-23)11-12-21(19)22/h9-10,16,20-21,23H,2,4-8,11-15H2,1,3H3 |
| InChIKey | RQPHXGIIYUEUAQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |