C25H39N — CID 170045186
1-[[(3aS,4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]methyl]piperidine (PubChem CID 170045186) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is 1-[[(3aS,4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]methyl]piperidine.
| Compound Name | 1-[[(3aS,4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 170045186 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | 1-[[(3aS,4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]methyl]piperidine |
| SMILES | C=C1CCCC/C1=C/C=C1\CCCC2(C)C(CN3CCCCC3)CC[C@@H]12 |
| InChI | InChI=1S/C25H39N/c1-20-9-4-5-10-21(20)12-13-22-11-8-16-25(2)23(14-15-24(22)25)19-26-17-6-3-7-18-26/h12-13,23-24H,1,3-11,14-19H2,2H3/b21-12-,22-13+/t23?,24-,25?/m0/s1 |
| InChIKey | ZHPYJJFIJFOCPH-FFQIKUARSA-N |
| XLogP | 6.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |