C30H52 — CID 142019823
(4E)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane (PubChem CID 142019823) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (4E)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane.
| Compound Name | (4E)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane |
|---|---|
| PubChem CID | 142019823 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (4E)-7a-methyl-1-[(E)-5-methylhex-2-enyl]-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene;ethane |
| SMILES | C=C1CCCC/C1=C/C=C1\CCCC2(C)C(C/C=C/CC(C)C)CCC12.CC.CC |
| InChI | InChI=1S/C26H40.2C2H6/c1-20(2)10-5-8-14-24-17-18-25-23(13-9-19-26(24,25)4)16-15-22-12-7-6-11-21(22)3;2*1-2/h5,8,15-16,20,24-25H,3,6-7,9-14,17-19H2,1-2,4H3;2*1-2H3/b8-5+,22-15-,23-16+;; |
| InChIKey | CRODMHIOJLLHGV-WTWOCVBLSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|