C29H48O6 — CID 44632015
(1R,2S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2,3-dihydroxypropoxy)-4-methylidenecyclohexane-1,3-diol (PubChem CID 44632015) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is (1R,2S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2,3-dihydroxypropoxy)-4-methylidenecyclohexane-1,3-diol.
| Compound Name | (1R,2S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2,3-dihydroxypropoxy)-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 44632015 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (1R,2S,3R,5Z)-5-[(2E)-2-[(1S,3aS,7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2,3-dihydroxypropoxy)-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H](CCCCC(C)(C)O)CC[C@@H]23)C[C@@H](O)[C@H](OCC(O)CO)[C@@H]1O |
| InChI | InChI=1S/C29H48O6/c1-19-21(16-25(32)27(26(19)33)35-18-23(31)17-30)11-10-20-8-7-15-29(4)22(12-13-24(20)29)9-5-6-14-28(2,3)34/h10-11,22-27,30-34H,1,5-9,12-18H2,2-4H3/b20-10+,21-11-/t22-,23?,24-,25+,26+,27-,29+/m0/s1 |
| InChIKey | HXEVPURLUXAGNO-IDHDKJSMSA-N |
| XLogP | 3.81 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|