C29H48N2O3 — CID 88949121
[(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-(4-hydroxy-4-methylpentyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] N-(3-aminopropyl)carbamate (PubChem CID 88949121) has the molecular formula C29H48N2O3 and a molecular weight of 472.71 g/mol. Its IUPAC name is [(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-(4-hydroxy-4-methylpentyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] N-(3-aminopropyl)carbamate.
| Compound Name | [(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-(4-hydroxy-4-methylpentyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 88949121 |
| Molecular Formula | C29H48N2O3 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | [(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-(4-hydroxy-4-methylpentyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] N-(3-aminopropyl)carbamate |
| SMILES | C=C1CC[C@H](OC(=O)NCCCN)C/C1=C/C=C1\CCC[C@]2(C)C(CCCC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C29H48N2O3/c1-21-10-14-25(34-27(32)31-19-7-18-30)20-23(21)12-11-22-8-5-17-29(4)24(13-15-26(22)29)9-6-16-28(2,3)33/h11-12,24-26,33H,1,5-10,13-20,30H2,2-4H3,(H,31,32)/b22-11+,23-12-/t24?,25-,26-,29+/m0/s1 |
| InChIKey | XCCMGJVRRNWCCS-TVVFBTGOSA-N |
| XLogP | 6.18 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|