C27H44O2 — CID 67646679
6-[(1S,3aS,4E,7aR)-4-[2-methoxy-2-[(1R,5S)-2-methylidene-1-bicyclo[3.1.0]hexanyl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhexan-2-ol (PubChem CID 67646679) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 6-[(1S,3aS,4E,7aR)-4-[2-methoxy-2-[(1R,5S)-2-methylidene-1-bicyclo[3.1.0]hexanyl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhexan-2-ol.
| Compound Name | 6-[(1S,3aS,4E,7aR)-4-[2-methoxy-2-[(1R,5S)-2-methylidene-1-bicyclo[3.1.0]hexanyl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 67646679 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 6-[(1S,3aS,4E,7aR)-4-[2-methoxy-2-[(1R,5S)-2-methylidene-1-bicyclo[3.1.0]hexanyl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhexan-2-ol |
| SMILES | C=C1CC[C@H]2C[C@]12C(/C=C1\CCC[C@]2(C)[C@@H](CCCCC(C)(C)O)CC[C@@H]12)OC |
| InChI | InChI=1S/C27H44O2/c1-19-11-12-22-18-27(19,22)24(29-5)17-20-9-8-16-26(4)21(13-14-23(20)26)10-6-7-15-25(2,3)28/h17,21-24,28H,1,6-16,18H2,2-5H3/b20-17+/t21-,22-,23-,24?,26+,27-/m0/s1 |
| InChIKey | JYADHGFXLCLLQR-MZJQQZOXSA-N |
| XLogP | 6.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|