C27H37NO3 — CID 166991356
2-[(2E)-2-[1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione (PubChem CID 166991356) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 2-[(2E)-2-[1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(2E)-2-[1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166991356 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 2-[(2E)-2-[1-(5-hydroxy-5-methylhexyl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)(O)CCCCC1CCC2/C(=C/CN3C(=O)c4ccccc4C3=O)CCCC12C |
| InChI | InChI=1S/C27H37NO3/c1-26(2,31)16-7-6-10-20-13-14-23-19(9-8-17-27(20,23)3)15-18-28-24(29)21-11-4-5-12-22(21)25(28)30/h4-5,11-12,15,20,23,31H,6-10,13-14,16-18H2,1-3H3/b19-15+ |
| InChIKey | NBHXXCIPFFHZEU-XDJHFCHBSA-N |
| XLogP | 5.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|