C26H45N3O — CID 163835570
(6R)-6-[(1R,3aS,4E,7aR)-4-[2-(4-butyltriazol-1-yl)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 163835570) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-4-[2-(4-butyltriazol-1-yl)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-(4-butyltriazol-1-yl)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163835570 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-(4-butyltriazol-1-yl)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | CCCCc1cn(C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]23)nn1 |
| InChI | InChI=1S/C26H45N3O/c1-6-7-12-22-19-29(28-27-22)18-15-21-11-9-17-26(5)23(13-14-24(21)26)20(2)10-8-16-25(3,4)30/h15,19-20,23-24,30H,6-14,16-18H2,1-5H3/b21-15+/t20-,23-,24+,26-/m1/s1 |
| InChIKey | UHKSSNGGYOULGH-UQMQRYHPSA-N |
| XLogP | 6.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|