C26H45N3O2 — CID 163946778
(6R)-6-[(1R,3aS,4E,7aR)-4-[2-[4-(4-hydroxybutyl)triazol-1-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 163946778) has the molecular formula C26H45N3O2 and a molecular weight of 431.67 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[4-(4-hydroxybutyl)triazol-1-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[4-(4-hydroxybutyl)triazol-1-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163946778 |
| Molecular Formula | C26H45N3O2 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.35 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[4-(4-hydroxybutyl)triazol-1-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/Cn3cc(CCCCO)nn3)CCC[C@]12C |
| InChI | InChI=1S/C26H45N3O2/c1-20(9-7-15-25(2,3)31)23-12-13-24-21(10-8-16-26(23,24)4)14-17-29-19-22(27-28-29)11-5-6-18-30/h14,19-20,23-24,30-31H,5-13,15-18H2,1-4H3/b21-14+/t20-,23-,24+,26-/m1/s1 |
| InChIKey | RVULDHDDSXDKPW-BVQPTJGISA-N |
| XLogP | 5.31 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|