C26H46O3 — CID 102581986
(Z,3R,7E)-7-[(7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-5-methylhept-5-ene-1,3-diol (PubChem CID 102581986) has the molecular formula C26H46O3 and a molecular weight of 406.65 g/mol. Its IUPAC name is (Z,3R,7E)-7-[(7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-5-methylhept-5-ene-1,3-diol.
| Compound Name | (Z,3R,7E)-7-[(7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-5-methylhept-5-ene-1,3-diol |
|---|---|
| PubChem CID | 102581986 |
| Molecular Formula | C26H46O3 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.34 |
| IUPAC Name | (Z,3R,7E)-7-[(7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-5-methylhept-5-ene-1,3-diol |
| SMILES | C/C(=C/C=C1\CCC[C@@]2(C)C1CCC2[C@H](C)CCCC(C)(C)O)C[C@@H](O)CCO |
| InChI | InChI=1S/C26H46O3/c1-19(18-22(28)14-17-27)10-11-21-9-7-16-26(5)23(12-13-24(21)26)20(2)8-6-15-25(3,4)29/h10-11,20,22-24,27-29H,6-9,12-18H2,1-5H3/b19-10-,21-11+/t20-,22+,23?,24?,26-/m1/s1 |
| InChIKey | NMQANXSTFNCMDU-CBLODMKDSA-N |
| XLogP | 5.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |