C29H50O4 — CID 143086971
(1S)-3-[(E)-2-[(7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-methylcyclohex-2-en-1-ol;propane-1,3-diol (PubChem CID 143086971) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is (1S)-3-[(E)-2-[(7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-methylcyclohex-2-en-1-ol;propane-1,3-diol.
| Compound Name | (1S)-3-[(E)-2-[(7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-methylcyclohex-2-en-1-ol;propane-1,3-diol |
|---|---|
| PubChem CID | 143086971 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (1S)-3-[(E)-2-[(7aR)-1-(5-hydroxy-5-methylhexyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-methylcyclohex-2-en-1-ol;propane-1,3-diol |
| SMILES | CC1=C(/C=C/C2=CCC[C@]3(C)C(CCCCC(C)(C)O)CCC23)CCC[C@@H]1O.OCCCO |
| InChI | InChI=1S/C26H42O2.C3H8O2/c1-19-20(9-7-12-24(19)27)13-14-21-10-8-18-26(4)22(15-16-23(21)26)11-5-6-17-25(2,3)28;4-2-1-3-5/h10,13-14,22-24,27-28H,5-9,11-12,15-18H2,1-4H3;4-5H,1-3H2/b14-13+;/t22?,23?,24-,26+;/m0./s1 |
| InChIKey | JPCQUUWAPKAWES-HUYAIQEZSA-N |
| XLogP | 5.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|