C25H40O3 — CID 134232070
5-[(1S,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2,2-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanoic acid (PubChem CID 134232070) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 5-[(1S,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2,2-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanoic acid.
| Compound Name | 5-[(1S,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2,2-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 134232070 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 5-[(1S,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2,2-dimethylcyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentanoic acid |
| SMILES | CC1(C)CC[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)[C@@H](CCCCC(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C25H40O3/c1-24(2)16-14-21(26)17-20(24)11-10-18-7-6-15-25(3)19(12-13-22(18)25)8-4-5-9-23(27)28/h10-11,19,21-22,26H,4-9,12-17H2,1-3H3,(H,27,28)/b18-10+,20-11-/t19-,21-,22-,25+/m0/s1 |
| InChIKey | YWTXDTDYQCALKZ-NTKLZEKMSA-N |
| XLogP | 6.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|