C26H46N2O2 — CID 143867487
(3Z)-3-[(2E)-2-[7a-methyl-1-[5-(methylamino)pentyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;2-aminoacetaldehyde (PubChem CID 143867487) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[7a-methyl-1-[5-(methylamino)pentyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;2-aminoacetaldehyde.
| Compound Name | (3Z)-3-[(2E)-2-[7a-methyl-1-[5-(methylamino)pentyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;2-aminoacetaldehyde |
|---|---|
| PubChem CID | 143867487 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | (3Z)-3-[(2E)-2-[7a-methyl-1-[5-(methylamino)pentyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;2-aminoacetaldehyde |
| SMILES | CNCCCCCC1CCC2/C(=C/C=C3/CCCC(O)C3)CCCC12C.NCC=O |
| InChI | InChI=1S/C24H41NO.C2H5NO/c1-24-16-7-9-20(13-12-19-8-6-11-22(26)18-19)23(24)15-14-21(24)10-4-3-5-17-25-2;3-1-2-4/h12-13,21-23,25-26H,3-11,14-18H2,1-2H3;2H,1,3H2/b19-12-,20-13+; |
| InChIKey | DYUYERWRDOAPDU-TYMVBTJCSA-N |
| XLogP | 4.91 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|