C24H38F2NO2P — CID 170043218
(3Z)-3-[(2E)-2-[(1R)-1-[2-[3-[difluoro(phosphanyl)methoxy]azetidin-1-yl]ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 170043218) has the molecular formula C24H38F2NO2P and a molecular weight of 441.54 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[(1R)-1-[2-[3-[difluoro(phosphanyl)methoxy]azetidin-1-yl]ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[(1R)-1-[2-[3-[difluoro(phosphanyl)methoxy]azetidin-1-yl]ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170043218 |
| Molecular Formula | C24H38F2NO2P |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (3Z)-3-[(2E)-2-[(1R)-1-[2-[3-[difluoro(phosphanyl)methoxy]azetidin-1-yl]ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC12CCC/C(=C\C=C3\CCCC(O)C3)C1CC[C@@H]2CCN1CC(OC(F)(F)P)C1 |
| InChI | InChI=1S/C24H38F2NO2P/c1-23-12-3-5-18(8-7-17-4-2-6-20(28)14-17)22(23)10-9-19(23)11-13-27-15-21(16-27)29-24(25,26)30/h7-8,19-22,28H,2-6,9-16,30H2,1H3/b17-7-,18-8+/t19-,20?,22?,23?/m1/s1 |
| InChIKey | JOFFBOBAPGYFEO-RWUOTYCJSA-N |
| XLogP | 5.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|