C23H40N2OS — CID 143867498
(3Z)-3-[(2E)-2-[1-[5-(aminosulfanylamino)pentyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 143867498) has the molecular formula C23H40N2OS and a molecular weight of 392.65 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[1-[5-(aminosulfanylamino)pentyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[1-[5-(aminosulfanylamino)pentyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143867498 |
| Molecular Formula | C23H40N2OS |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (3Z)-3-[(2E)-2-[1-[5-(aminosulfanylamino)pentyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC12CCC/C(=C\C=C3\CCCC(O)C3)C1CCC2CCCCCNSN |
| InChI | InChI=1S/C23H40N2OS/c1-23-15-6-8-19(12-11-18-7-5-10-21(26)17-18)22(23)14-13-20(23)9-3-2-4-16-25-27-24/h11-12,20-22,25-26H,2-10,13-17,24H2,1H3/b18-11-,19-12+ |
| InChIKey | ZQKVQTCDJZSMSQ-VHVWWYSBSA-N |
| XLogP | 5.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|