C25H40O2 — CID 143539657
(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(E)-5-hydroxy-5-methylhex-2-enyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 143539657) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(E)-5-hydroxy-5-methylhex-2-enyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(E)-5-hydroxy-5-methylhex-2-enyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143539657 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(E)-5-hydroxy-5-methylhex-2-enyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC(C)(O)C/C=C/C[C@H]1CCC2/C(=C/C=C3/CCC[C@H](O)C3)CCC[C@@]21C |
| InChI | InChI=1S/C25H40O2/c1-24(2,27)16-5-4-10-21-14-15-23-20(9-7-17-25(21,23)3)13-12-19-8-6-11-22(26)18-19/h4-5,12-13,21-23,26-27H,6-11,14-18H2,1-3H3/b5-4+,19-12-,20-13+/t21-,22-,23?,25+/m0/s1 |
| InChIKey | FTMUYQRSQSOQPY-CFHKXURJSA-N |
| XLogP | 6.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|