C28H48O2 — CID 142882330
ethane;(3Z)-3-[(2E)-2-[5-[(E)-5-hydroxy-5-methylhex-2-enyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 142882330) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is ethane;(3Z)-3-[(2E)-2-[5-[(E)-5-hydroxy-5-methylhex-2-enyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | ethane;(3Z)-3-[(2E)-2-[5-[(E)-5-hydroxy-5-methylhex-2-enyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 142882330 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | ethane;(3Z)-3-[(2E)-2-[5-[(E)-5-hydroxy-5-methylhex-2-enyl]-4a-methyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC.CC(C)(O)C/C=C/CC1CCCC2/C(=C/C=C3/CCCC(O)C3)CCCC12C |
| InChI | InChI=1S/C26H42O2.C2H6/c1-25(2,28)17-5-4-11-22-12-7-14-24-21(10-8-18-26(22,24)3)16-15-20-9-6-13-23(27)19-20;1-2/h4-5,15-16,22-24,27-28H,6-14,17-19H2,1-3H3;1-2H3/b5-4+,20-15-,21-16+; |
| InChIKey | PDZIHRKSFIWAJZ-ZDDMUOPYSA-N |
| XLogP | 7.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|