C32H56O3 — CID 143298720
6-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,6,10-trimethylundecane-2,10-diol (PubChem CID 143298720) has the molecular formula C32H56O3 and a molecular weight of 488.80 g/mol. Its IUPAC name is 6-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,6,10-trimethylundecane-2,10-diol.
| Compound Name | 6-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,6,10-trimethylundecane-2,10-diol |
|---|---|
| PubChem CID | 143298720 |
| Molecular Formula | C32H56O3 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.42 |
| IUPAC Name | 6-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,6,10-trimethylundecane-2,10-diol |
| SMILES | CC(C)(O)CCCC(C)(CCCC(C)(C)O)C1CCC2/C(=C/C=C3/CCCC(O)C3)CCCC21C |
| InChI | InChI=1S/C32H56O3/c1-29(2,34)18-9-20-31(5,21-10-19-30(3,4)35)28-17-16-27-25(12-8-22-32(27,28)6)15-14-24-11-7-13-26(33)23-24/h14-15,26-28,33-35H,7-13,16-23H2,1-6H3/b24-14-,25-15+ |
| InChIKey | AZLLMDYGXUXDIV-WJVNUPORSA-N |
| XLogP | 7.88 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |