C27H45NO2 — CID 170044296
3-ethyl-1-[2-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl]piperidin-3-ol (PubChem CID 170044296) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is 3-ethyl-1-[2-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl]piperidin-3-ol.
| Compound Name | 3-ethyl-1-[2-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 170044296 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | 3-ethyl-1-[2-[(4E)-4-[(2Z)-2-(3-hydroxycyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethyl]piperidin-3-ol |
| SMILES | CCC1(O)CCCN(CCC2CCC3/C(=C/C=C4/CCCC(O)C4)CCCC23C)C1 |
| InChI | InChI=1S/C27H45NO2/c1-3-27(30)16-6-17-28(20-27)18-14-23-12-13-25-22(8-5-15-26(23,25)2)11-10-21-7-4-9-24(29)19-21/h10-11,23-25,29-30H,3-9,12-20H2,1-2H3/b21-10-,22-11+ |
| InChIKey | GLOSMZNWUXGIBE-PANSPLHPSA-N |
| XLogP | 5.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |