C24H37NO — CID 170044006
(3Z)-3-[(2E)-2-[(1R)-1-methyl-1-(pyrrolidin-1-ylmethyl)-2,3,3a,5,6,7-hexahydro-1aH-cyclopropa[i]inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 170044006) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[(1R)-1-methyl-1-(pyrrolidin-1-ylmethyl)-2,3,3a,5,6,7-hexahydro-1aH-cyclopropa[i]inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[(1R)-1-methyl-1-(pyrrolidin-1-ylmethyl)-2,3,3a,5,6,7-hexahydro-1aH-cyclopropa[i]inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170044006 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (3Z)-3-[(2E)-2-[(1R)-1-methyl-1-(pyrrolidin-1-ylmethyl)-2,3,3a,5,6,7-hexahydro-1aH-cyclopropa[i]inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | C[C@@]1(CN2CCCC2)C2CCC3/C(=C/C=C4/CCCC(O)C4)CCCC321 |
| InChI | InChI=1S/C24H37NO/c1-23(17-25-14-2-3-15-25)22-12-11-21-19(7-5-13-24(21,22)23)10-9-18-6-4-8-20(26)16-18/h9-10,20-22,26H,2-8,11-17H2,1H3/b18-9-,19-10+/t20?,21?,22?,23-,24?/m1/s1 |
| InChIKey | SJCZKIYKAJYZEE-FTELKXFLSA-N |
| XLogP | 5.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |